CymitQuimica logo

CAS 123387-67-7

:

1,1-Dimethylethyl 2-(tributylstannyl)-1-pyrrolidinecarboxylate

Description:
1,1-Dimethylethyl 2-(tributylstannyl)-1-pyrrolidinecarboxylate, with CAS number 123387-67-7, is an organotin compound characterized by the presence of a tributylstannyl group attached to a pyrrolidinecarboxylate moiety. This compound typically exhibits a relatively high molecular weight due to the bulky tributylstannyl group, which contributes to its unique physical and chemical properties. It is likely to be a viscous liquid or solid at room temperature, depending on its specific formulation and purity. The presence of the pyrrolidine ring suggests potential reactivity, particularly in nucleophilic substitution reactions. Organotin compounds are known for their applications in various fields, including as stabilizers in polymers and as biocides, although their use is regulated due to environmental and health concerns. The compound's stability, solubility, and reactivity can be influenced by the steric and electronic effects of the substituents, making it of interest in synthetic organic chemistry and materials science.
Formula:C21H43NO2Sn
InChI:InChI=1S/C9H16NO2.3C4H9.Sn/c1-9(2,3)12-8(11)10-6-4-5-7-10;3*1-3-4-2;/h6H,4-5,7H2,1-3H3;3*1,3-4H2,2H3;
InChI key:InChIKey=PZUXJSXENZTXMP-UHFFFAOYSA-N
SMILES:[Sn](CCCC)(CCCC)(CCCC)C1N(C(OC(C)(C)C)=O)CCC1
Synonyms:
  • 1-Pyrrolidinecarboxylic acid, 2-(tributylstannyl)-, 1,1-dimethylethyl ester
  • 1,1-Dimethylethyl 2-(tributylstannyl)-1-pyrrolidinecarboxylate
  • tert-Butyl 2-tributylstannyl-1-pyrrolidinecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.