CAS 1233951-89-7

1,1-Dimethylethyl 4-[[[(4-nitrophenyl)amino]carbonyl]amino]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 4-[[[(4-nitrophenyl)amino]carbonyl]amino]-1-piperidinecarboxylate, with the CAS number 1233951-89-7, is a chemical compound characterized by its complex structure, which includes a piperidine ring, a nitrophenyl group, and a tert-butyl substituent. This compound typically exhibits properties associated with both amines and esters, including potential solubility in organic solvents and moderate stability under standard conditions. The presence of the nitrophenyl group suggests that it may possess notable electronic properties, potentially influencing its reactivity and interactions in chemical reactions. Additionally, the piperidine moiety can contribute to its biological activity, making it of interest in medicinal chemistry. The compound may also exhibit specific functional characteristics, such as hydrogen bonding capabilities and steric hindrance due to the bulky tert-butyl group, which can affect its pharmacokinetic properties. Overall, this compound's unique structural features may render it useful in various applications, including drug development and synthetic chemistry.

Formula: C₁₇H₂₄N₄O₅

InChI: InChI=1S/C17H24N4O5/c1-17(2,3)26-16(23)20-10-8-13(9-11-20)19-15(22)18-12-4-6-14(7-5-12)21(24)25/h4-7,13H,8-11H2,1-3H3,(H2,18,19,22)

InChI key: InChIKey=YNACFAXKPZHECB-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CCC(NC(NC2=CC=C(N(=O)=O)C=C2)=O)CC1

Synonyms:

• 1-Piperidinecarboxylic acid, 4-[[[(4-nitrophenyl)amino]carbonyl]amino]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 4-[[[(4-nitrophenyl)amino]carbonyl]amino]-1-piperidinecarboxylate

tert-Butyl 4-[3-(4-nitrophenyl)ureido]piperidine-1-carboxylate

CAS: 1233951-89-7

Formula: C₁₇H₂₄N₄O₅

Purity: 95.0%

Molecular weight: 364.402

Ref: 10-F063539