CAS 1233952-08-3

Piperazine, 1-(3-fluoro-2-nitrophenyl)-, hydrochloride (1:1)

Description:

Piperazine, 1-(3-fluoro-2-nitrophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. The presence of a 3-fluoro-2-nitrophenyl substituent indicates that the compound has both fluorine and nitro functional groups, which can influence its reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The compound may exhibit properties such as antimicrobial or anti-parasitic activity, owing to the piperazine structure, which is often found in drugs targeting central nervous system disorders and other therapeutic areas. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity associated with the nitro and fluoro groups.

Formula: C₁₀H₁₂FN₃O₂·ClH

InChI: InChI=1S/C10H12FN3O2.ClH/c11-8-2-1-3-9(10(8)14(15)16)13-6-4-12-5-7-13;/h1-3,12H,4-7H2;1H

InChI key: InChIKey=KETWAQSPEFPGMQ-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(C=CC=C1F)N2CCNCC2.Cl

Synonyms:

• Piperazine, 1-(3-fluoro-2-nitrophenyl)-, hydrochloride (1:1)

1-(3-Fluoro-2-nitrophenyl)piperazine hydrochloride

CAS: 1233952-08-3

Formula: C₁₀H₁₃ClFN₃O₂

Purity: 95.0%

Molecular weight: 261.68

Ref: 10-F063692