CAS 1233952-09-4

1,1-Dimethylethyl 4-[(3-nitrobenzoyl)amino]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 4-[(3-nitrobenzoyl)amino]-1-piperidinecarboxylate, identified by its CAS number 1233952-09-4, is a chemical compound characterized by its complex structure, which includes a piperidine ring, a carboxylate group, and a nitrobenzoyl moiety. This compound typically exhibits properties associated with both amines and esters, making it potentially useful in various chemical applications, including medicinal chemistry and organic synthesis. The presence of the nitro group suggests that it may have specific reactivity patterns, such as electrophilic substitution or reduction reactions. Additionally, the dimethyl substituents on the piperidine ring can influence its steric and electronic properties, potentially affecting its biological activity and solubility. As with many organic compounds, its stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, this compound's unique structural features may contribute to its utility in research and development within the pharmaceutical and chemical industries.

Formula: C₁₇H₂₃N₃O₅

InChI: InChI=1S/C17H23N3O5/c1-17(2,3)25-16(22)19-9-7-13(8-10-19)18-15(21)12-5-4-6-14(11-12)20(23)24/h4-6,11,13H,7-10H2,1-3H3,(H,18,21)

InChI key: InChIKey=XVUGYASNBHHQBN-UHFFFAOYSA-N

SMILES: C(NC1CCN(C(OC(C)(C)C)=O)CC1)(=O)C2=CC(N(=O)=O)=CC=C2

Synonyms:

• 1,1-Dimethylethyl 4-[(3-nitrobenzoyl)amino]-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 4-[(3-nitrobenzoyl)amino]-, 1,1-dimethylethyl ester

tert-Butyl 4-(3-nitrobenzamido)piperidine-1-carboxylate

CAS: 1233952-09-4

Formula: C₁₇H₂₃N₃O₅

Purity: 95.0%

Molecular weight: 349.387

Ref: 10-F063399