CAS 1233952-17-4

Piperazine, 1-(2-fluoro-6-nitrophenyl)-, hydrochloride (1:1)

Description:

Piperazine, 1-(2-fluoro-6-nitrophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. The presence of a 2-fluoro-6-nitrophenyl group indicates that the compound has both fluorine and nitro substituents on the aromatic ring, which can influence its reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The nitro group is known for its potential to participate in reduction reactions, while the fluorine atom can affect the compound's lipophilicity and metabolic stability. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. However, specific biological activities, toxicity, and detailed applications would require further investigation through empirical studies and literature review.

Formula: C₁₀H₁₂FN₃O₂·ClH

InChI: InChI=1S/C10H12FN3O2.ClH/c11-8-2-1-3-9(14(15)16)10(8)13-6-4-12-5-7-13;/h1-3,12H,4-7H2;1H

InChI key: InChIKey=GZVKKOFFODQSRF-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(C(F)=CC=C1)N2CCNCC2.Cl

Synonyms:

• Piperazine, 1-(2-fluoro-6-nitrophenyl)-, hydrochloride (1:1)

1-(2-Fluoro-6-nitrophenyl)piperazine hydrochloride

CAS: 1233952-17-4

Formula: C₁₀H₁₃ClFN₃O₂

Purity: 95.0%

Molecular weight: 261.68

Ref: 10-F063697