CAS 1233952-19-6

Benzenesulfonamide, 4-bromo-N-4-piperidinyl-, hydrochloride (1:1)

Description:

Benzenesulfonamide, 4-bromo-N-4-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of a bromine atom at the para position of the benzene ring enhances its reactivity and may influence its biological activity. The piperidine moiety contributes to the compound's potential pharmacological effects, as piperidine derivatives are often associated with various therapeutic applications. As a hydrochloride salt, it is typically more soluble in water, which can facilitate its use in biological studies or pharmaceutical formulations. This compound may exhibit properties such as moderate to high stability under standard conditions, but specific reactivity can depend on the surrounding environment and conditions. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. However, detailed studies would be necessary to fully elucidate its properties, including its efficacy, safety, and mechanism of action in biological systems.

Formula: C₁₁H₁₅BrN₂O₂S·ClH

InChI: InChI=1S/C11H15BrN2O2S.ClH/c12-9-1-3-11(4-2-9)17(15,16)14-10-5-7-13-8-6-10;/h1-4,10,13-14H,5-8H2;1H

InChI key: InChIKey=JNATWDCCMWHPBH-UHFFFAOYSA-N

SMILES: S(NC1CCNCC1)(=O)(=O)C2=CC=C(Br)C=C2.Cl

Synonyms:

• Benzenesulfonamide, 4-bromo-N-4-piperidinyl-, hydrochloride (1:1)

4-Bromo-N-(piperidin-4-yl)benzenesulfonamide hydrochloride

CAS: 1233952-19-6

Formula: C₁₁H₁₆BrClN₂O₂S

Purity: 95.0%

Molecular weight: 355.68

Ref: 10-F063765