CAS 1233952-42-5

1,1-Dimethylethyl 4-[(2-hydroxy-2-methyl-1-oxopropyl)amino]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 4-[(2-hydroxy-2-methyl-1-oxopropyl)amino]-1-piperidinecarboxylate, identified by its CAS number 1233952-42-5, is a chemical compound that features a piperidine ring, which is a six-membered nitrogen-containing heterocycle. This compound is characterized by the presence of a tert-butyl group (1,1-dimethylethyl) and an amino group linked to a hydroxy ketone moiety, contributing to its potential biological activity. The structure suggests that it may exhibit properties relevant to medicinal chemistry, possibly acting as a pharmaceutical agent or a biochemical probe. Its functional groups indicate potential for hydrogen bonding and interactions with biological targets. The compound's solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, making it important for applications in drug formulation and development. Further studies would be necessary to elucidate its pharmacological properties and potential therapeutic uses.

Formula: C₁₄H₂₆N₂O₄

InChI: InChI=1S/C14H26N2O4/c1-13(2,3)20-12(18)16-8-6-10(7-9-16)15-11(17)14(4,5)19/h10,19H,6-9H2,1-5H3,(H,15,17)

InChI key: InChIKey=GAZKAKHVQFWLOO-UHFFFAOYSA-N

SMILES: N(C(C(C)(C)O)=O)C1CCN(C(OC(C)(C)C)=O)CC1

Synonyms:

• 1,1-Dimethylethyl 4-[(2-hydroxy-2-methyl-1-oxopropyl)amino]-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 4-[(2-hydroxy-2-methyl-1-oxopropyl)amino]-, 1,1-dimethylethyl ester

tert-Butyl 4-(2-hydroxy-2-methylpropanamido)piperidine-1-carboxylate

CAS: 1233952-42-5

Formula: C₁₄H₂₆N₂O₄

Purity: 95.0%

Molecular weight: 286.372

Ref: 10-F063506