CAS 1233952-46-9

4-Piperidinamine, N-[(4-methoxyphenyl)methyl]-, hydrochloride (1:2)

Description:

4-Piperidinamine, N-[(4-methoxyphenyl)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features a methoxyphenyl group attached to the nitrogen atom of the piperidine, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the methoxy group may influence the compound's lipophilicity and, consequently, its pharmacokinetic properties. This compound may exhibit various biological activities, making it of interest in medicinal chemistry. Its specific interactions and effects would depend on its structural attributes and the biological systems it targets. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory or industrial settings. Further studies would be necessary to fully elucidate its properties and potential applications in drug development or other fields.

Formula: C₁₃H₂₀N₂O·2ClH

InChI: InChI=1S/C13H20N2O.2ClH/c1-16-13-4-2-11(3-5-13)10-15-12-6-8-14-9-7-12;;/h2-5,12,14-15H,6-10H2,1H3;2*1H

InChI key: InChIKey=VTQODYCNBLZPCY-UHFFFAOYSA-N

SMILES: C(NC1CCNCC1)C2=CC=C(OC)C=C2.Cl

Synonyms:

• 4-Piperidinamine, N-[(4-methoxyphenyl)methyl]-, hydrochloride (1:2)

N-(4-Methoxybenzyl)piperidine-4-amine dihydrochloride

CAS: 1233952-46-9

Formula: C₁₃H₂₂Cl₂N₂O

Purity: 95.0%

Molecular weight: 293.23

Ref: 10-F063409