CAS 1233952-56-1

Urea, N-(3-fluorophenyl)-N′-4-piperidinyl-, hydrochloride (1:1)

Description:

Urea, N-(3-fluorophenyl)-N′-4-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its urea functional group, which is central to its structure. This compound features a 3-fluorophenyl group and a piperidine moiety, contributing to its potential biological activity. The hydrochloride form indicates that it is a salt, which often enhances solubility in water and may influence its pharmacokinetic properties. The presence of the fluorine atom can modify the compound's electronic properties, potentially affecting its interaction with biological targets. Typically, compounds of this nature are investigated for their pharmacological applications, particularly in the fields of medicinal chemistry and drug development. The specific characteristics, such as melting point, solubility, and stability, would depend on the precise molecular interactions and the environment in which the compound is studied. As with many chemical substances, safety data and handling precautions are essential for laboratory work involving this compound.

Formula: C₁₂H₁₆FN₃O·ClH

InChI: InChI=1S/C12H16FN3O.ClH/c13-9-2-1-3-11(8-9)16-12(17)15-10-4-6-14-7-5-10;/h1-3,8,10,14H,4-7H2,(H2,15,16,17);1H

InChI key: InChIKey=SZGITINPZYTNCI-UHFFFAOYSA-N

SMILES: N(C(NC1CCNCC1)=O)C2=CC(F)=CC=C2.Cl

Synonyms:

• Urea, N-(3-fluorophenyl)-N′-4-piperidinyl-, hydrochloride (1:1)

1-(3-Fluorophenyl)-3-(piperidin-4-yl)urea hydrochloride

CAS: 1233952-56-1

Formula: C₁₂H₁₇ClFN₃O

Purity: 95.0%

Molecular weight: 273.74

Ref: 10-F063482