CAS 1233952-85-6

1,1-Dimethylethyl 4-[[4-(methoxycarbonyl)benzoyl]amino]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 4-[[4-(methoxycarbonyl)benzoyl]amino]-1-piperidinecarboxylate, identified by its CAS number 1233952-85-6, is a chemical compound that features a complex structure incorporating a piperidine ring, a dimethyl substituent, and a benzoyl moiety with a methoxycarbonyl group. This compound is characterized by its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The presence of the piperidine ring contributes to its basicity and potential for forming hydrogen bonds, which can enhance its solubility and reactivity. The methoxycarbonyl group may influence its lipophilicity and overall pharmacokinetic properties. Additionally, the compound's structural features suggest it may exhibit specific biological activities, making it a candidate for further research in drug discovery. As with many organic compounds, its stability, reactivity, and interactions with other substances will depend on environmental conditions such as pH, temperature, and solvent polarity.

Formula: C₁₉H₂₆N₂O₅

InChI: InChI=1S/C19H26N2O5/c1-19(2,3)26-18(24)21-11-9-15(10-12-21)20-16(22)13-5-7-14(8-6-13)17(23)25-4/h5-8,15H,9-12H2,1-4H3,(H,20,22)

InChI key: InChIKey=KBJIZQOTTBEPNQ-UHFFFAOYSA-N

SMILES: N(C(=O)C1=CC=C(C(OC)=O)C=C1)C2CCN(C(OC(C)(C)C)=O)CC2

Synonyms:

• 1-Piperidinecarboxylic acid, 4-[[4-(methoxycarbonyl)benzoyl]amino]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 4-[[4-(methoxycarbonyl)benzoyl]amino]-1-piperidinecarboxylate

tert-Butyl 4-[4-(methoxycarbonyl)benzamido]piperidine-1-carboxylate

CAS: 1233952-85-6

Formula: C₁₉H₂₆N₂O₅

Purity: 95.0%

Molecular weight: 362.426

Ref: 10-F063772