CAS 1233952-95-8

Urea, N-phenyl-N′-4-piperidinyl-, hydrochloride (1:1)

Description:

Urea, N-phenyl-N′-4-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its urea functional group, which is linked to a phenyl group and a piperidine moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The piperidine ring contributes to its basicity and potential biological activity, making it of interest in medicinal chemistry. Its structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting the central nervous system or other therapeutic areas. As with many compounds containing nitrogen, it may exhibit various interactions, including hydrogen bonding, which can influence its reactivity and biological interactions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₂H₁₇N₃O·ClH

InChI: InChI=1S/C12H17N3O.ClH/c16-12(14-10-4-2-1-3-5-10)15-11-6-8-13-9-7-11;/h1-5,11,13H,6-9H2,(H2,14,15,16);1H

InChI key: InChIKey=ODFHMUFOYVLRGY-UHFFFAOYSA-N

SMILES: N(C(NC1CCNCC1)=O)C2=CC=CC=C2.Cl

Synonyms:

• Urea, N-phenyl-N′-4-piperidinyl-, hydrochloride (1:1)