CAS 1233953-06-4

4-(3-Fluoro-2-nitrophenoxy)tetrahydro-2H-pyran

Description:

4-(3-Fluoro-2-nitrophenoxy)tetrahydro-2H-pyran is a chemical compound characterized by its unique molecular structure, which includes a tetrahydropyran ring and a phenoxy group substituted with a fluorine atom and a nitro group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. The presence of the nitro group suggests that it may participate in electrophilic aromatic substitution reactions, while the fluorine atom can influence the compound's electronic properties and lipophilicity. The tetrahydropyran moiety adds to the compound's cyclic structure, which can affect its conformational flexibility and interactions with biological targets. Such compounds are often of interest in medicinal chemistry and materials science due to their potential applications in drug development and as intermediates in organic synthesis. Overall, the specific characteristics, including melting point, boiling point, and solubility, would require empirical data for precise determination, but the structural features provide insight into its chemical behavior and potential applications.

Formula: C₁₁H₁₂FNO₄

InChI: InChI=1S/C11H12FNO4/c12-9-2-1-3-10(11(9)13(14)15)17-8-4-6-16-7-5-8/h1-3,8H,4-7H2

InChI key: InChIKey=BMVLICRCIQROQG-UHFFFAOYSA-N

SMILES: O(C1=C(N(=O)=O)C(F)=CC=C1)C2CCOCC2

Synonyms:

• 2H-Pyran, 4-(3-fluoro-2-nitrophenoxy)tetrahydro-
• 4-(3-Fluoro-2-nitrophenoxy)tetrahydro-2H-pyran

4-(3-Fluoro-2-nitrophenoxy)tetrahydro-2H-pyran

CAS: 1233953-06-4

Formula: C₁₁H₁₂FNO₄

Purity: 95.0%

Molecular weight: 241.218

Ref: 10-F063637