CAS 1233953-10-0

4-Piperidinamine, N-[(4-nitrophenyl)methyl]-, hydrochloride (1:2)

Description:

4-Piperidinamine, N-[(4-nitrophenyl)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. The compound features a nitrophenyl group, which contributes to its potential reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in various applications, including pharmaceuticals and research. The presence of the nitro group may impart specific electronic properties, influencing the compound's interactions with biological targets. This substance may exhibit properties such as basicity due to the amine functional group, and it could participate in hydrogen bonding, affecting its solubility and reactivity. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents. However, safety and handling precautions should be observed, as compounds with nitro groups can sometimes be associated with toxicity or environmental concerns.

Formula: C₁₂H₁₇N₃O₂·2ClH

InChI: InChI=1S/C12H17N3O2.2ClH/c16-15(17)12-3-1-10(2-4-12)9-14-11-5-7-13-8-6-11;;/h1-4,11,13-14H,5-9H2;2*1H

InChI key: InChIKey=BNZDJXDDCMMAIW-UHFFFAOYSA-N

SMILES: C(NC1CCNCC1)C2=CC=C(N(=O)=O)C=C2.Cl

Synonyms:

• 4-Piperidinamine, N-[(4-nitrophenyl)methyl]-, hydrochloride (1:2)

N-(4-Nitrobenzyl)piperidine-4-amine dihydrochloride

CAS: 1233953-10-0

Formula: C₁₂H₁₉Cl₂N₃O₂

Purity: 95.0%

Molecular weight: 308.2

Ref: 10-F063474