CAS 1233953-15-5

1,1-Dimethylethyl 4-[[[(2-methylphenyl)amino]carbonyl]amino]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 4-[[[(2-methylphenyl)amino]carbonyl]amino]-1-piperidinecarboxylate, identified by its CAS number 1233953-15-5, is a chemical compound characterized by its complex structure, which includes a piperidine ring and multiple functional groups. This substance features a dimethyl group attached to a tert-butyl moiety, contributing to its steric bulk. The presence of an amino group linked to a carbonyl indicates potential for hydrogen bonding and reactivity, while the aromatic 2-methylphenyl group suggests hydrophobic characteristics. The carboxylate functionality implies that the compound may exhibit acidic properties, influencing its solubility and interaction with biological systems. Additionally, the compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both amine and carboxylate groups that can participate in various chemical reactions. Overall, this compound's unique combination of functional groups and structural features makes it of interest in both synthetic and applied chemistry contexts.

Formula: C₁₈H₂₇N₃O₃

InChI: InChI=1S/C18H27N3O3/c1-13-7-5-6-8-15(13)20-16(22)19-14-9-11-21(12-10-14)17(23)24-18(2,3)4/h5-8,14H,9-12H2,1-4H3,(H2,19,20,22)

InChI key: InChIKey=KPXAXQGXZBMNBP-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CCC(NC(NC2=C(C)C=CC=C2)=O)CC1

Synonyms:

• 1-Piperidinecarboxylic acid, 4-[[[(2-methylphenyl)amino]carbonyl]amino]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 4-[[[(2-methylphenyl)amino]carbonyl]amino]-1-piperidinecarboxylate

tert-Butyl 4-(3-o-tolylureido)piperidine-1-carboxylate

CAS: 1233953-15-5

Formula: C₁₈H₂₇N₃O₃

Purity: 95.0%

Molecular weight: 333.432

Ref: 10-F063505