CAS 1233954-86-3

1,1-Dimethylethyl 4-[[(3-fluorophenyl)sulfonyl]amino]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 4-[[(3-fluorophenyl)sulfonyl]amino]-1-piperidinecarboxylate, identified by its CAS number 1233954-86-3, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a sulfonamide functional group. This compound typically exhibits properties associated with both amines and esters, contributing to its potential biological activity. The presence of the 3-fluorophenyl group suggests that it may have specific interactions with biological targets, potentially influencing its pharmacological profile. The dimethyl substituents on the ethyl group can enhance lipophilicity, affecting solubility and permeability through biological membranes. Additionally, the sulfonyl group may impart stability and influence reactivity, making it a candidate for various applications in medicinal chemistry. Overall, this compound's unique structural features may contribute to its utility in drug development, particularly in the context of targeting specific receptors or enzymes in therapeutic applications.

Formula: C₁₆H₂₃FN₂O₄S

InChI: InChI=1S/C16H23FN2O4S/c1-16(2,3)23-15(20)19-9-7-13(8-10-19)18-24(21,22)14-6-4-5-12(17)11-14/h4-6,11,13,18H,7-10H2,1-3H3

InChI key: InChIKey=HGOQZQXMCHUXOE-UHFFFAOYSA-N

SMILES: S(NC1CCN(C(OC(C)(C)C)=O)CC1)(=O)(=O)C2=CC(F)=CC=C2

Synonyms:

• 1-Piperidinecarboxylic acid, 4-[[(3-fluorophenyl)sulfonyl]amino]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 4-[[(3-fluorophenyl)sulfonyl]amino]-1-piperidinecarboxylate

tert-Butyl 4-(3-fluorophenylsulfonamido)piperidine-1-carboxylate

CAS: 1233954-86-3

Formula: C₁₆H₂₃FN₂O₄S

Purity: 95.0%

Molecular weight: 358.43

Ref: 10-F063513