CAS 1233954-94-3

1,1-Dimethylethyl 4-[(1-oxopropyl)amino]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 4-[(1-oxopropyl)amino]-1-piperidinecarboxylate, identified by its CAS number 1233954-94-3, is a chemical compound that features a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. This compound is characterized by the presence of a tert-butyl group (1,1-dimethylethyl) and an amide functional group, specifically a propanoyl moiety attached to the nitrogen of the piperidine. The ester functionality is indicated by the carboxylate group, which suggests that this compound may exhibit properties typical of both amines and esters. Its structure implies potential applications in medicinal chemistry, possibly as a pharmaceutical intermediate or a bioactive compound. The presence of the piperidine ring often correlates with biological activity, making it a subject of interest in drug design. Additionally, the compound's solubility, stability, and reactivity would depend on its specific functional groups and the overall molecular structure, which could influence its interactions in biological systems.

Formula: C₁₃H₂₄N₂O₃

InChI: InChI=1S/C13H24N2O3/c1-5-11(16)14-10-6-8-15(9-7-10)12(17)18-13(2,3)4/h10H,5-9H2,1-4H3,(H,14,16)

InChI key: InChIKey=DRZBTHJOPQIKPQ-UHFFFAOYSA-N

SMILES: N(C(CC)=O)C1CCN(C(OC(C)(C)C)=O)CC1

Synonyms:

• 1,1-Dimethylethyl 4-[(1-oxopropyl)amino]-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 4-[(1-oxopropyl)amino]-, 1,1-dimethylethyl ester

tert-Butyl 4-propionamidopiperidine-1-carboxylate

CAS: 1233954-94-3

Formula: C₁₃H₂₄N₂O₃

Purity: 95.0%

Molecular weight: 256.346

Ref: 10-F063360