CAS 1233955-03-7

Urea, N-(2-methylphenyl)-N′-4-piperidinyl-, hydrochloride (1:1)

Description:

Urea, N-(2-methylphenyl)-N′-4-piperidinyl-, hydrochloride (1:1), with the CAS number 1233955-03-7, is a chemical compound characterized by its urea functional group, which is central to its structure. This compound features a piperidine ring, contributing to its potential biological activity, and a 2-methylphenyl group, which may influence its lipophilicity and interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the piperidine moiety suggests potential use in medicinal chemistry, particularly in the development of psychoactive or analgesic agents. Its specific properties, such as melting point, solubility, and stability, would depend on the conditions of synthesis and storage. Safety data and handling precautions are essential, as with all chemical substances, to mitigate any risks associated with its use in laboratory or industrial settings.

Formula: C₁₃H₁₉N₃O·ClH

InChI: InChI=1S/C13H19N3O.ClH/c1-10-4-2-3-5-12(10)16-13(17)15-11-6-8-14-9-7-11;/h2-5,11,14H,6-9H2,1H3,(H2,15,16,17);1H

InChI key: InChIKey=INZWYGKJZLVDAH-UHFFFAOYSA-N

SMILES: N(C(NC1CCNCC1)=O)C2=C(C)C=CC=C2.Cl

Synonyms:

• Urea, N-(2-methylphenyl)-N′-4-piperidinyl-, hydrochloride (1:1)

1-(Piperidin-4-yl)-3-o-tolylurea hydrochloride

CAS: 1233955-03-7

Formula: C₁₃H₂₀ClN₃O

Purity: 95.0%

Molecular weight: 269.77

Ref: 10-F063487