CAS 1233955-08-2

4-Morpholinecarboxamide, N-4-piperidinyl-, hydrochloride (1:1)

Description:

4-Morpholinecarboxamide, N-4-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its morpholine and piperidine functional groups, which contribute to its potential biological activity. This substance typically appears as a white to off-white crystalline solid and is soluble in water, indicating its ionic nature due to the presence of the hydrochloride salt. The compound may exhibit properties such as moderate to high polarity, which can influence its interaction with biological systems. It is often studied for its pharmacological potential, particularly in the context of medicinal chemistry, where derivatives of morpholine and piperidine are known for their roles in various therapeutic applications. The presence of the carboxamide group suggests potential hydrogen bonding capabilities, which can enhance its solubility and bioavailability. Safety and handling precautions are essential, as with any chemical, to mitigate risks associated with exposure. Overall, this compound's unique structure positions it as a candidate for further research in drug development and related fields.

Formula: C₁₀H₁₉N₃O₂·ClH

InChI: InChI=1S/C10H19N3O2.ClH/c14-10(13-5-7-15-8-6-13)12-9-1-3-11-4-2-9;/h9,11H,1-8H2,(H,12,14);1H

InChI key: InChIKey=MXENSSIIOOQNBU-UHFFFAOYSA-N

SMILES: C(NC1CCNCC1)(=O)N2CCOCC2.Cl

Synonyms:

• 4-Morpholinecarboxamide, N-4-piperidinyl-, hydrochloride (1:1)

N-(Piperidin-4-yl)morpholine-4-carboxamide hydrochloride

CAS: 1233955-08-2

Formula: C₁₀H₂₀ClN₃O₂

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 249.74

Ref: 10-F063562