CAS 1233955-12-8
:2-Fluoro-N-(3-methoxypropyl)-6-nitrobenzenamine
Description:
2-Fluoro-N-(3-methoxypropyl)-6-nitrobenzenamine is an organic compound characterized by its aromatic structure, which includes a nitro group and a fluorine atom attached to a benzene ring. The presence of the amino group (-NH2) indicates that it is an aniline derivative, which can participate in various chemical reactions, such as electrophilic substitutions. The methoxypropyl substituent contributes to its solubility and reactivity, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. The fluorine atom enhances the compound's lipophilicity and can influence its biological activity. Additionally, the nitro group is known for its electron-withdrawing properties, which can affect the compound's reactivity and stability. Overall, this compound's unique combination of functional groups suggests potential utility in synthetic organic chemistry and medicinal chemistry, although specific applications would depend on further research and testing. Safety and handling precautions should be observed due to the presence of the nitro group, which can pose hazards.
Formula:C10H13FN2O3
InChI:InChI=1S/C10H13FN2O3/c1-16-7-3-6-12-10-8(11)4-2-5-9(10)13(14)15/h2,4-5,12H,3,6-7H2,1H3
InChI key:InChIKey=LDTQMIJZUJULIS-UHFFFAOYSA-N
SMILES:N(CCCOC)C1=C(N(=O)=O)C=CC=C1F
Synonyms:- 2-Fluoro-N-(3-methoxypropyl)-6-nitrobenzenamine
- Benzenamine, 2-fluoro-N-(3-methoxypropyl)-6-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
