CAS 1233955-17-3

1-Fluoro-2-(2-methylpropoxy)-3-nitrobenzene

Description:

1-Fluoro-2-(2-methylpropoxy)-3-nitrobenzene is an organic compound characterized by the presence of a fluorine atom, a nitro group, and a branched alkoxy substituent on a benzene ring. The molecular structure features a nitro group (-NO2) at the meta position relative to the fluorine atom, which can influence the compound's reactivity and polarity. The 2-methylpropoxy group contributes to its hydrophobic characteristics, potentially affecting solubility in various solvents. This compound may exhibit interesting electronic properties due to the electron-withdrawing nature of the nitro group and the electron-donating characteristics of the alkoxy substituent. As a result, it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The presence of the fluorine atom may also enhance the compound's stability and alter its interaction with biological systems, making it of interest in fields such as medicinal chemistry and materials science. Overall, 1-Fluoro-2-(2-methylpropoxy)-3-nitrobenzene presents a unique combination of functional groups that can be explored for diverse applications.

Formula: C₁₀H₁₂FNO₃

InChI: InChI=1S/C10H12FNO3/c1-7(2)6-15-10-8(11)4-3-5-9(10)12(13)14/h3-5,7H,6H2,1-2H3

InChI key: InChIKey=OMJCHCJAEMSERQ-UHFFFAOYSA-N

SMILES: O(CC(C)C)C1=C(N(=O)=O)C=CC=C1F

Synonyms:

• Benzene, 1-fluoro-2-(2-methylpropoxy)-3-nitro-
• 1-Fluoro-2-(2-methylpropoxy)-3-nitrobenzene

1-Fluoro-2-isobutoxy-3-nitrobenzene

CAS: 1233955-17-3

Formula: C₁₀H₁₂FNO₃

Purity: 95.0%

Molecular weight: 213.208

Ref: 10-F063646