CymitQuimica logo

CAS 1233955-19-5

:

1,1-Dimethylethyl 4-[[(diethylamino)carbonyl]amino]-1-piperidinecarboxylate

Description:
1,1-Dimethylethyl 4-[[(diethylamino)carbonyl]amino]-1-piperidinecarboxylate, identified by CAS number 1233955-19-5, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a diethylamino group. This compound typically exhibits properties associated with amides and esters, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The dimethyl substituents contribute to steric hindrance, which can influence its reactivity and interaction with biological targets. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where the piperidine moiety is often associated with various biological activities. Additionally, the presence of the diethylamino group may enhance its lipophilicity, affecting its pharmacokinetic properties. Overall, this compound's unique characteristics make it a subject of interest in chemical research and drug development.
Formula:C15H29N3O3
InChI:InChI=1S/C15H29N3O3/c1-6-17(7-2)13(19)16-12-8-10-18(11-9-12)14(20)21-15(3,4)5/h12H,6-11H2,1-5H3,(H,16,19)
InChI key:InChIKey=RDBJZFBMFDFWOP-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CCC(NC(N(CC)CC)=O)CC1
Synonyms:
  • 1-Piperidinecarboxylic acid, 4-[[(diethylamino)carbonyl]amino]-, 1,1-dimethylethyl ester
  • 1,1-Dimethylethyl 4-[[(diethylamino)carbonyl]amino]-1-piperidinecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.