CAS 1233955-31-1

1,1-Dimethylethyl 4-[[[(2-chlorophenyl)amino]carbonyl]amino]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 4-[[[(2-chlorophenyl)amino]carbonyl]amino]-1-piperidinecarboxylate, with the CAS number 1233955-31-1, is a chemical compound characterized by its complex structure that includes a piperidine ring, a dimethyl group, and a chlorophenyl moiety. This compound typically exhibits properties associated with amides and esters, such as moderate solubility in organic solvents and potential reactivity towards nucleophiles due to the presence of the carbonyl group. The chlorophenyl group may impart specific biological activity, making it of interest in pharmaceutical research. The presence of the piperidine ring suggests potential applications in medicinal chemistry, particularly in the development of compounds targeting various biological pathways. Additionally, the steric hindrance introduced by the dimethyl group can influence the compound's interaction with biological targets, potentially affecting its pharmacokinetics and pharmacodynamics. Overall, this compound's unique structural features contribute to its potential utility in drug development and other chemical applications.

Formula: C₁₇H₂₄ClN₃O₃

InChI: InChI=1S/C17H24ClN3O3/c1-17(2,3)24-16(23)21-10-8-12(9-11-21)19-15(22)20-14-7-5-4-6-13(14)18/h4-7,12H,8-11H2,1-3H3,(H2,19,20,22)

InChI key: InChIKey=HIFXZICDAAMLAZ-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CCC(NC(NC2=C(Cl)C=CC=C2)=O)CC1

Synonyms:

• 1-Piperidinecarboxylic acid, 4-[[[(2-chlorophenyl)amino]carbonyl]amino]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 4-[[[(2-chlorophenyl)amino]carbonyl]amino]-1-piperidinecarboxylate

tert-Butyl 4-[3-(2-chlorophenyl)ureido]piperidine-1-carboxylate

CAS: 1233955-31-1

Formula: C₁₇H₂₄ClN₃O₃

Purity: 95.0%

Molecular weight: 353.85

Ref: 10-F063565