CAS 1233955-32-2

Urea, N-(4-chlorophenyl)-N′-4-piperidinyl-, hydrochloride (1:1)

Description:

Urea, N-(4-chlorophenyl)-N′-4-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its urea functional group, which is linked to a 4-chlorophenyl moiety and a piperidine ring. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, reflecting its polar nature due to the presence of the urea and hydrochloride groups. The presence of the 4-chlorophenyl group may impart specific biological activities, making it of interest in pharmaceutical research. The piperidine ring contributes to its basicity and potential interactions with biological targets. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. Safety data should be consulted for handling and exposure, as compounds with similar structures may exhibit toxicity or other health effects. Overall, this compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents.

Formula: C₁₂H₁₆ClN₃O·ClH

InChI: InChI=1S/C12H16ClN3O.ClH/c13-9-1-3-10(4-2-9)15-12(17)16-11-5-7-14-8-6-11;/h1-4,11,14H,5-8H2,(H2,15,16,17);1H

InChI key: InChIKey=RKFKSDABRXRRPV-UHFFFAOYSA-N

SMILES: N(C(NC1CCNCC1)=O)C2=CC=C(Cl)C=C2.Cl

Synonyms:

• Urea, N-(4-chlorophenyl)-N′-4-piperidinyl-, hydrochloride (1:1)

1-(4-Chlorophenyl)-3-(piperidin-4-yl)urea hydrochloride

CAS: 1233955-32-2

Formula: C₁₂H₁₇Cl₂N₃O

Purity: 95.0%

Molecular weight: 290.19

Ref: 10-F063485