CAS 1233955-37-7

Urea, N-(3-methylphenyl)-N′-4-piperidinyl-, hydrochloride (1:1)

Description:

Urea, N-(3-methylphenyl)-N′-4-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its urea functional group, which is central to its structure. This compound features a piperidine ring, contributing to its potential biological activity, and a 3-methylphenyl group that enhances its lipophilicity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can influence its pharmacokinetic properties. The presence of the piperidine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting the central nervous system. The compound's molecular interactions may be influenced by hydrogen bonding due to the urea group, and its overall stability can be affected by environmental factors such as pH and temperature. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including drug development and chemical synthesis.

Formula: C₁₃H₁₉N₃O·ClH

InChI: InChI=1S/C13H19N3O.ClH/c1-10-3-2-4-12(9-10)16-13(17)15-11-5-7-14-8-6-11;/h2-4,9,11,14H,5-8H2,1H3,(H2,15,16,17);1H

InChI key: InChIKey=LHNXNVHBBARETB-UHFFFAOYSA-N

SMILES: N(C(NC1CCNCC1)=O)C2=CC(C)=CC=C2.Cl

Synonyms:

• Urea, N-(3-methylphenyl)-N′-4-piperidinyl-, hydrochloride (1:1)

1-(Piperidin-4-yl)-3-m-tolylurea hydrochloride

CAS: 1233955-37-7

Formula: C₁₃H₂₀ClN₃O

Purity: 95.0%

Molecular weight: 269.77

Ref: 10-F063530