
CAS 1233955-49-1
:Benzenesulfonamide, 4-methoxy-N-4-piperidinyl-, hydrochloride (1:1)
Description:
Benzenesulfonamide, 4-methoxy-N-4-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of a methoxy group and a piperidine ring contributes to its pharmacological profile, potentially enhancing its solubility and bioavailability. This compound is typically encountered as a hydrochloride salt, which improves its stability and facilitates its use in various applications, particularly in medicinal chemistry. The molecular structure suggests that it may interact with biological targets, making it of interest in drug development. Its properties, such as melting point, solubility, and reactivity, are influenced by the functional groups present, which can affect its behavior in biological systems. As with many sulfonamides, it may exhibit antibacterial activity, although specific biological activities would depend on further empirical studies. Safety and handling precautions are essential, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C12H18N2O3S·ClH
InChI:InChI=1S/C12H18N2O3S.ClH/c1-17-11-2-4-12(5-3-11)18(15,16)14-10-6-8-13-9-7-10;/h2-5,10,13-14H,6-9H2,1H3;1H
InChI key:InChIKey=WJKOEWDTFUDOTF-UHFFFAOYSA-N
SMILES:S(NC1CCNCC1)(=O)(=O)C2=CC=C(OC)C=C2.Cl
Synonyms:- Benzenesulfonamide, 4-methoxy-N-4-piperidinyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.