CymitQuimica logo

CAS 1233955-56-0

:

trans-4-[(5-Amino-2-pyridinyl)amino]cyclohexanol

Description:
Trans-4-[(5-Amino-2-pyridinyl)amino]cyclohexanol is a chemical compound characterized by its unique structure, which includes a cyclohexanol ring substituted with an amino group and a pyridine moiety. This compound is typically classified as an amino alcohol, which suggests it possesses both hydroxyl (-OH) and amino (-NH2) functional groups. The presence of the pyridine ring contributes to its potential biological activity, as pyridine derivatives are often involved in various pharmacological applications. The trans configuration indicates that the substituents on the cyclohexanol ring are positioned opposite to each other, which can influence the compound's stereochemistry and reactivity. Additionally, the compound may exhibit solubility in polar solvents due to the hydroxyl group, while the amino group can participate in hydrogen bonding, enhancing its interactions in biological systems. Overall, trans-4-[(5-Amino-2-pyridinyl)amino]cyclohexanol is of interest in medicinal chemistry and may serve as a scaffold for the development of therapeutic agents.
Formula:C11H17N3O
InChI:InChI=1/C11H17N3O/c12-8-1-6-11(13-7-8)14-9-2-4-10(15)5-3-9/h1,6-7,9-10,15H,2-5,12H2,(H,13,14)/t9-,10-
InChI key:InChIKey=PSJLVIOGQMEMPY-MGCOHNPYNA-N
SMILES:N([C@@H]1CC[C@@H](O)CC1)C2=CC=C(N)C=N2
Synonyms:
  • Cyclohexanol, 4-[(5-amino-2-pyridinyl)amino]-, trans-
  • trans-4-[(5-Amino-2-pyridinyl)amino]cyclohexanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.