CAS 1233955-58-2
:trans-4-[(2-Amino-6-fluorophenyl)amino]cyclohexanol
Description:
Trans-4-[(2-Amino-6-fluorophenyl)amino]cyclohexanol, identified by its CAS number 1233955-58-2, is a chemical compound characterized by its unique structural features, including a cyclohexanol ring and an amino group substituted with a fluorophenyl moiety. This compound exhibits properties typical of amines and alcohols, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the hydroxyl group. The presence of the fluorine atom can influence its electronic properties, potentially enhancing its reactivity or altering its biological activity. Additionally, the trans configuration of the cyclohexanol moiety may affect its spatial orientation and steric interactions, which are crucial for its function in biological systems or as a pharmaceutical agent. Overall, this compound's characteristics make it of interest in medicinal chemistry, particularly in the development of therapeutic agents targeting specific biological pathways. Further studies would be necessary to elucidate its full range of properties and potential applications.
Formula:C12H17FN2O
InChI:InChI=1/C12H17FN2O/c13-10-2-1-3-11(14)12(10)15-8-4-6-9(16)7-5-8/h1-3,8-9,15-16H,4-7,14H2/t8-,9-
InChI key:InChIKey=QMKNUGVOFMXQFA-KYZUINATNA-N
SMILES:N(C1=C(F)C=CC=C1N)[C@@H]2CC[C@@H](O)CC2
Synonyms:- Cyclohexanol, 4-[(2-amino-6-fluorophenyl)amino]-, trans-
- trans-4-[(2-Amino-6-fluorophenyl)amino]cyclohexanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
