
CAS 1233955-61-7
:1-(2-Fluoro-6-nitrophenyl)pyrrolidine
Description:
1-(2-Fluoro-6-nitrophenyl)pyrrolidine is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a substituted phenyl group. The presence of a fluorine atom and a nitro group on the phenyl ring contributes to its chemical reactivity and potential applications in medicinal chemistry. The fluorine atom can enhance lipophilicity and influence the compound's pharmacokinetic properties, while the nitro group may participate in various chemical reactions, including reduction to amines. This compound is likely to exhibit polar characteristics due to the electronegative substituents, affecting its solubility in different solvents. Additionally, the pyrrolidine moiety may impart basic properties, allowing for interactions with biological targets. Overall, 1-(2-Fluoro-6-nitrophenyl)pyrrolidine is of interest in research contexts, particularly in the development of pharmaceuticals or agrochemicals, where modifications to its structure can lead to varied biological activities. Safety and handling precautions should be observed due to the potential hazards associated with its components.
Formula:C10H11FN2O2
InChI:InChI=1S/C10H11FN2O2/c11-8-4-3-5-9(13(14)15)10(8)12-6-1-2-7-12/h3-5H,1-2,6-7H2
InChI key:InChIKey=QJQZIIGCNJGTMH-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C(F)=CC=C1)N2CCCC2
Synonyms:- 1-(2-Fluoro-6-nitrophenyl)pyrrolidine
- Pyrrolidine, 1-(2-fluoro-6-nitrophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
