CAS 1233955-62-8

4-[(4-Fluoro-2-nitrophenoxy)methyl]-1-methylpiperidine

Description:

4-[(4-Fluoro-2-nitrophenoxy)methyl]-1-methylpiperidine is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. The presence of a methyl group at the 1-position of the piperidine enhances its lipophilicity, potentially influencing its biological activity. The compound features a 4-fluoro-2-nitrophenoxy group, which introduces both a fluorine atom and a nitro group on the aromatic ring, contributing to its electronic properties and reactivity. The fluorine atom can enhance the compound's metabolic stability, while the nitro group may participate in various chemical reactions, including reduction. This compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its structure suggests potential interactions with biological targets, which could be explored in drug development. However, detailed studies would be necessary to fully understand its behavior, including solubility, stability, and biological activity. As with many synthetic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₃H₁₇FN₂O₃

InChI: InChI=1S/C13H17FN2O3/c1-15-6-4-10(5-7-15)9-19-13-3-2-11(14)8-12(13)16(17)18/h2-3,8,10H,4-7,9H2,1H3

InChI key: InChIKey=BKFDNHMLPPTHAS-UHFFFAOYSA-N

SMILES: O(CC1CCN(C)CC1)C2=C(N(=O)=O)C=C(F)C=C2

Synonyms:

• 4-[(4-Fluoro-2-nitrophenoxy)methyl]-1-methylpiperidine
• Piperidine, 4-[(4-fluoro-2-nitrophenoxy)methyl]-1-methyl-

4-[(4-Fluoro-2-nitrophenoxy)methyl]-1-methylpiperidine

CAS: 1233955-62-8

Formula: C₁₃H₁₇FN₂O₃

Purity: 95.0%

Molecular weight: 268.288

Ref: 10-F063596