CAS 1233955-63-9

4-Piperidinamine, N-[(2-nitrophenyl)methyl]-, hydrochloride (1:2)

Description:

4-Piperidinamine, N-[(2-nitrophenyl)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a nitrophenyl group indicates that the compound has a nitro substituent on a phenyl ring, contributing to its potential reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its utility in various applications, including pharmaceuticals. The compound may exhibit properties such as basicity due to the amine functional group, and it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Its specific applications and biological activities would depend on its interaction with biological targets, making it of interest in medicinal chemistry and drug development. Safety and handling precautions should be observed, as compounds with nitro groups can sometimes be hazardous.

Formula: C₁₂H₁₇N₃O₂·2ClH

InChI: InChI=1S/C12H17N3O2.2ClH/c16-15(17)12-4-2-1-3-10(12)9-14-11-5-7-13-8-6-11;;/h1-4,11,13-14H,5-9H2;2*1H

InChI key: InChIKey=XPMALDDAQVONTA-UHFFFAOYSA-N

SMILES: C(NC1CCNCC1)C2=C(N(=O)=O)C=CC=C2.Cl

Synonyms:

• 4-Piperidinamine, N-[(2-nitrophenyl)methyl]-, hydrochloride (1:2)

N-(2-Nitrobenzyl)piperidine-4-amine dihydrochloride

CAS: 1233955-63-9

Formula: C₁₂H₁₉Cl₂N₃O₂

Purity: 95.0%

Molecular weight: 308.2

Ref: 10-F063410