CAS 1233955-65-1

2H-1,3-Oxazin-2-one, tetrahydro-3-(4-piperidinyl)-, hydrochloride (1:1)

Description:

2H-1,3-Oxazin-2-one, tetrahydro-3-(4-piperidinyl)-, hydrochloride (1:1) is a chemical compound characterized by its oxazine ring structure, which contributes to its stability and reactivity. The presence of a tetrahydro group indicates that the compound is saturated, enhancing its solubility in polar solvents. The piperidine moiety suggests potential biological activity, as piperidine derivatives are often associated with pharmacological properties. The hydrochloride salt form indicates that the compound is protonated, which typically increases its solubility in aqueous solutions and may influence its bioavailability. This compound may exhibit properties such as moderate to high polarity, making it suitable for various applications in medicinal chemistry and drug development. Its specific interactions, such as binding affinity to biological targets, would depend on its three-dimensional conformation and functional groups. Overall, this compound's unique structural features position it as a candidate for further investigation in therapeutic contexts, particularly in areas related to central nervous system activity or other pharmacological effects.

Formula: C₉H₁₆N₂O₂·ClH

InChI: InChI=1S/C9H16N2O2.ClH/c12-9-11(6-1-7-13-9)8-2-4-10-5-3-8;/h8,10H,1-7H2;1H

InChI key: InChIKey=XCDPYGIFWHJFJU-UHFFFAOYSA-N

SMILES: O=C1N(C2CCNCC2)CCCO1.Cl

Synonyms:

• 2H-1,3-Oxazin-2-one, tetrahydro-3-(4-piperidinyl)-, hydrochloride (1:1)

3-(Piperidin-4-yl)-1,3-oxazinan-2-one hydrochloride

CAS: 1233955-65-1

Versatile small molecule scaffold

Formula: C₉H₁₇ClN₂O₂

Purity: Min. 95%

Molecular weight: 220.69 g/mol

Ref: 3D-IZB95565