CAS 1233955-69-5

1,1-Dimethylethyl 4-[[(methylamino)carbonyl]amino]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 4-[[(methylamino)carbonyl]amino]-1-piperidinecarboxylate, identified by its CAS number 1233955-69-5, is a chemical compound characterized by its complex structure, which includes a piperidine ring and various functional groups such as a dimethyl group and a methylamino carbonyl moiety. This compound typically exhibits properties associated with both amines and esters, suggesting potential solubility in polar solvents and moderate reactivity due to the presence of the carbonyl group. The piperidine ring contributes to its cyclic nature, which can influence its biological activity and interaction with other molecules. Additionally, the presence of the dimethyl group may enhance lipophilicity, affecting its pharmacokinetic properties. Such compounds are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their ability to interact with biological targets. Overall, the characteristics of this compound make it a subject of interest in various fields, including organic synthesis and drug development.

Formula: C₁₂H₂₃N₃O₃

InChI: InChI=1S/C12H23N3O3/c1-12(2,3)18-11(17)15-7-5-9(6-8-15)14-10(16)13-4/h9H,5-8H2,1-4H3,(H2,13,14,16)

InChI key: InChIKey=SINHKVHBWLTXJX-UHFFFAOYSA-N

SMILES: N(C(NC)=O)C1CCN(C(OC(C)(C)C)=O)CC1

Synonyms:

• 1-Piperidinecarboxylic acid, 4-[[(methylamino)carbonyl]amino]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 4-[[(methylamino)carbonyl]amino]-1-piperidinecarboxylate
• tert-Butyl 4-(3-methylureido)piperidine-1-carboxylate

tert-Butyl 4-(3-methylureido)piperidine-1-carboxylate

CAS: 1233955-69-5

Formula: C₁₂H₂₃N₃O₃

Purity: 95.0%

Molecular weight: 257.334

Ref: 10-F063563