CAS 1233955-72-0

Benzamide, 3-nitro-N-4-piperidinyl-, hydrochloride (1:1)

Description:

Benzamide, 3-nitro-N-4-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its benzamide structure, which features a nitro group at the 3-position and a piperidine moiety at the N-4 position. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in aqueous solutions. The presence of the nitro group contributes to its potential reactivity and biological activity, making it of interest in pharmaceutical research. The piperidine ring is known for its role in various biological activities, often serving as a pharmacophore in drug design. The compound's molecular interactions may involve hydrogen bonding and π-π stacking due to its aromatic nature. As with many nitro-substituted compounds, it may exhibit specific properties such as increased lipophilicity and potential for metabolic transformation. Safety and handling precautions are essential, as nitro compounds can sometimes be associated with toxicity or environmental concerns. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry and related fields.

Formula: C₁₂H₁₅N₃O₃·ClH

InChI: InChI=1S/C12H15N3O3.ClH/c16-12(14-10-4-6-13-7-5-10)9-2-1-3-11(8-9)15(17)18;/h1-3,8,10,13H,4-7H2,(H,14,16);1H

InChI key: InChIKey=UADSMRVNLRVESN-UHFFFAOYSA-N

SMILES: C(NC1CCNCC1)(=O)C2=CC(N(=O)=O)=CC=C2.Cl

Synonyms:

• Benzamide, 3-nitro-N-4-piperidinyl-, hydrochloride (1:1)

3-Nitro-N-(piperidine-4-yl)benzamido hydrochloride

CAS: 1233955-72-0

Formula: C₁₂H₁₆ClN₃O₃

Purity: 95.0%

Molecular weight: 285.73

Ref: 10-F063400