CAS 1233955-75-3

Propanamide, 2-hydroxy-2-methyl-N-4-piperidinyl-, hydrochloride (1:1)

Description:

Propanamide, 2-hydroxy-2-methyl-N-4-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group and a piperidine ring, which contributes to its pharmacological properties. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form. The presence of the hydroxyl and piperidinyl groups suggests potential interactions with biological systems, making it of interest in medicinal chemistry. Its molecular structure indicates that it may exhibit properties such as being a potential drug candidate, with applications in various therapeutic areas. The hydrochloride form enhances its stability and solubility, which is crucial for bioavailability in pharmaceutical formulations. As with many amides, it may also participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory or industrial settings.

Formula: C₉H₁₈N₂O₂·ClH

InChI: InChI=1S/C9H18N2O2.ClH/c1-9(2,13)8(12)11-7-3-5-10-6-4-7;/h7,10,13H,3-6H2,1-2H3,(H,11,12);1H

InChI key: InChIKey=SHBDDXGQAILLBP-UHFFFAOYSA-N

SMILES: N(C(C(C)(C)O)=O)C1CCNCC1.Cl

Synonyms:

• Propanamide, 2-hydroxy-2-methyl-N-4-piperidinyl-, hydrochloride (1:1)

2-Hydroxy-2-methyl-N-(piperidin-4-yl)propanamide hydrochloride

CAS: 1233955-75-3

Formula: C₉H₁₉ClN₂O₂

Purity: 95.0%

Molecular weight: 222.71

Ref: 10-F063545