CAS 1233955-79-7

Ethyl 1-(2-amino-3-fluorophenyl)-4-piperidinecarboxylate

Description:

Ethyl 1-(2-amino-3-fluorophenyl)-4-piperidinecarboxylate is a chemical compound characterized by its complex structure, which includes an ethyl ester group, an amino group, and a piperidine ring. The presence of the fluorine atom on the phenyl ring contributes to its unique reactivity and potential biological activity. This compound is typically classified as an organic molecule and may exhibit properties such as solubility in organic solvents, moderate stability under standard conditions, and potential interactions with biological systems due to its amine functionality. The piperidine ring can influence the compound's pharmacological properties, making it of interest in medicinal chemistry. Its specific applications may vary, but it could be explored for use in drug development or as a research chemical. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage and minimize risks associated with exposure.

Formula: C₁₄H₁₉FN₂O₂

InChI: InChI=1S/C14H19FN2O2/c1-2-19-14(18)10-6-8-17(9-7-10)12-5-3-4-11(15)13(12)16/h3-5,10H,2,6-9,16H2,1H3

InChI key: InChIKey=XPEOSPJDZJVUBS-UHFFFAOYSA-N

SMILES: NC1=C(C=CC=C1F)N2CCC(C(OCC)=O)CC2

Synonyms:

• Ethyl 1-(2-amino-3-fluorophenyl)-4-piperidinecarboxylate
• 4-Piperidinecarboxylic acid, 1-(2-amino-3-fluorophenyl)-, ethyl ester

Ethyl 1-(2-amino-3-fluorophenyl)piperidine-4-carboxylate

CAS: 1233955-79-7

Formula: C₁₄H₁₉FN₂O₂

Purity: 95.0%

Molecular weight: 266.316

Ref: 10-F063613