CAS 1233955-83-3

4-Piperidinamine, N-(4-fluoro-2-nitrophenyl)-, hydrochloride (1:1)

Description:

4-Piperidinamine, N-(4-fluoro-2-nitrophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. The compound features a nitrophenyl group substituted at the piperidine nitrogen, specifically a 4-fluoro-2-nitrophenyl moiety, indicating the presence of both a fluorine atom and a nitro group on the aromatic ring. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, particularly in pharmaceutical contexts. The presence of the nitro group suggests potential biological activity, as nitro compounds can participate in various chemical reactions and may exhibit pharmacological properties. The compound's molecular structure contributes to its overall stability and reactivity, making it of interest in medicinal chemistry and related fields. Safety and handling precautions should be observed due to the potential toxicity associated with nitro compounds.

Formula: C₁₁H₁₄FN₃O₂·ClH

InChI: InChI=1S/C11H14FN3O2.ClH/c12-8-1-2-10(11(7-8)15(16)17)14-9-3-5-13-6-4-9;/h1-2,7,9,13-14H,3-6H2;1H

InChI key: InChIKey=GPEXRSBNLHNEHD-UHFFFAOYSA-N

SMILES: N(C1=C(N(=O)=O)C=C(F)C=C1)C2CCNCC2.Cl

Synonyms:

• 4-Piperidinamine, N-(4-fluoro-2-nitrophenyl)-, hydrochloride (1:1)

N-(4-Fluoro-2-nitrophenyl)piperidin-4-amine hydrochloride

CAS: 1233955-83-3

Formula: C₁₁H₁₅ClFN₃O₂

Purity: 95.0%

Molecular weight: 275.71

Ref: 10-F063699