CAS 1233955-84-4: 4-Piperidinamine, N-[(3-chlorophenyl)methyl]-, hydrochloride (1:2)

Description:4-Piperidinamine, N-[(3-chlorophenyl)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a chlorophenyl group indicates that a chlorine atom is substituted on the phenyl ring, which can influence the compound's reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water than its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit properties such as being a potential intermediate in organic synthesis or having pharmacological significance, possibly acting as a ligand or inhibitor in biological systems. Its molecular structure suggests it may interact with various biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Further characterization would typically involve techniques such as NMR, IR spectroscopy, and mass spectrometry to confirm its structure and purity.

Formula:C₁₂H₁₇ClN₂·2ClH

InChI:InChI=1S/C12H17ClN2.2ClH/c13-11-3-1-2-10(8-11)9-15-12-4-6-14-7-5-12;;/h1-3,8,12,14-15H,4-7,9H2;2*1H

InChI key:InChIKey=FHBVBHPTEVKZRP-UHFFFAOYSA-N

SMILES:Cl.ClC1=CC=CC(=C1)CNC2CCNCC2

Synonyms:
4-Piperidinamine, N-[(3-chlorophenyl)methyl]-, hydrochloride (1:2)

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	N-(3-Chlorobenzyl)piperidine-4-amine dihydrochloride REF: 10-F063367CAS: 1233955-84-4	95.0%	To inquire	Wed 23 Apr 25
	N-(3-Chlorobenzyl)piperidine-4-amine dihydrochloride REF: 3D-IZB95584CAS: 1233955-84-4	Min. 95%	- - -	Discontinued product