CAS 1233955-85-5

2-Pyridinemethanamine, N-4-piperidinyl-, hydrochloride (1:2)

Description:

2-Pyridinemethanamine, N-4-piperidinyl-, hydrochloride (1:2) is a chemical compound characterized by its structure, which includes a pyridine ring and a piperidine moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form. It is often used in pharmaceutical research and development, particularly in the synthesis of various biologically active molecules. The presence of both the pyridine and piperidine groups suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the hydrochloride form enhances its stability and solubility, facilitating its use in various applications. Safety data sheets should be consulted for handling and toxicity information, as with any chemical substance. Overall, this compound exemplifies the diverse functionalities that nitrogen-containing heterocycles can offer in chemical and pharmaceutical contexts.

Formula: C₁₁H₁₇N₃·2ClH

InChI: InChI=1S/C11H17N3.2ClH/c1-2-6-13-11(3-1)9-14-10-4-7-12-8-5-10;;/h1-3,6,10,12,14H,4-5,7-9H2;2*1H

InChI key: InChIKey=RYTPYNXSZDMPME-UHFFFAOYSA-N

SMILES: C(NC1CCNCC1)C2=CC=CC=N2.Cl

Synonyms:

• 2-Pyridinemethanamine, N-4-piperidinyl-, hydrochloride (1:2)

N-(Pyridin-2-ylmethyl)piperidine-4-aminedihydrochloride

CAS: 1233955-85-5

Formula: C₁₁H₁₉Cl₂N₃

Purity: 95.0%

Molecular weight: 264.19

Ref: 10-F063470