CAS 1233958-23-0

Benzenesulfonamide, 3-bromo-N-4-piperidinyl-, hydrochloride (1:1)

Description:

Benzenesulfonamide, 3-bromo-N-4-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of a bromine atom at the 3-position of the benzene ring contributes to its reactivity and potential biological activity. The piperidine moiety enhances its pharmacological profile, often influencing its interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water, which is advantageous for pharmaceutical applications. This compound may exhibit properties such as antimicrobial activity, making it of interest in medicinal chemistry. Its structure suggests potential applications in drug development, particularly in the synthesis of compounds targeting various diseases. Safety and handling precautions are essential due to the potential toxicity associated with sulfonamide derivatives. Overall, this compound represents a significant class of chemicals with diverse applications in both research and therapeutic contexts.

Formula: C₁₁H₁₅BrN₂O₂S·ClH

InChI: InChI=1S/C11H15BrN2O2S.ClH/c12-9-2-1-3-11(8-9)17(15,16)14-10-4-6-13-7-5-10;/h1-3,8,10,13-14H,4-7H2;1H

InChI key: InChIKey=MDILHDIEBWBFHI-UHFFFAOYSA-N

SMILES: S(NC1CCNCC1)(=O)(=O)C2=CC(Br)=CC=C2.Cl

Synonyms:

• Benzenesulfonamide, 3-bromo-N-4-piperidinyl-, hydrochloride (1:1)

3-Bromo-N-(piperidin-4-yl)benzenesulfonamide hydrochloride

CAS: 1233958-23-0

Formula: C₁₁H₁₆BrClN₂O₂S

Purity: 95.0%

Molecular weight: 355.68

Ref: 10-F063517