CAS 1233958-25-2

Urea, N-(2-bromophenyl)-N′-4-piperidinyl-, hydrochloride (1:1)

Description:

Urea, N-(2-bromophenyl)-N′-4-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its urea functional group, which is central to its structure. The presence of a 2-bromophenyl group indicates that it has a bromine atom substituted on the phenyl ring, contributing to its potential reactivity and biological activity. The piperidine moiety suggests that the compound may exhibit properties typical of piperidine derivatives, such as potential psychoactive effects or interactions with neurotransmitter systems. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may be of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its specific characteristics, including melting point, solubility, and biological activity, would depend on its precise molecular interactions and the context of its use. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous.

Formula: C₁₂H₁₆BrN₃O·ClH

InChI: InChI=1S/C12H16BrN3O.ClH/c13-10-3-1-2-4-11(10)16-12(17)15-9-5-7-14-8-6-9;/h1-4,9,14H,5-8H2,(H2,15,16,17);1H

InChI key: InChIKey=OSGBQMHVBJPTKP-UHFFFAOYSA-N

SMILES: N(C(NC1CCNCC1)=O)C2=C(Br)C=CC=C2.Cl

Synonyms:

• Urea, N-(2-bromophenyl)-N′-4-piperidinyl-, hydrochloride (1:1)

1-(2-Bromophenyl)-3-(piperidin-4-yl)ureahydrochloride

CAS: 1233958-25-2

Formula: C₁₂H₁₇BrClN₃O

Purity: 95.0%

Molecular weight: 334.64

Ref: 10-F063554