CAS 1233958-29-6

Benzenesulfonamide, 4-nitro-N-4-piperidinyl-, hydrochloride (1:1)

Description:

Benzenesulfonamide, 4-nitro-N-4-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of a nitro group on the benzene ring enhances its reactivity and potential biological activity. The piperidine moiety contributes to its pharmacological profile, often influencing its solubility and interaction with biological targets. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, facilitating its use in various applications, including pharmaceuticals. This compound may exhibit properties such as antimicrobial activity, making it of interest in medicinal chemistry. Its molecular structure allows for potential interactions with enzymes or receptors, which can be explored for therapeutic purposes. Safety and handling precautions are essential, as with many sulfonamide derivatives, due to potential allergic reactions or toxicity. Overall, this compound represents a class of sulfonamides with diverse applications in drug development and research.

Formula: C₁₁H₁₅N₃O₄S·ClH

InChI: InChI=1S/C11H15N3O4S.ClH/c15-14(16)10-1-3-11(4-2-10)19(17,18)13-9-5-7-12-8-6-9;/h1-4,9,12-13H,5-8H2;1H

InChI key: InChIKey=NVDGYSCHKOLJRI-UHFFFAOYSA-N

SMILES: S(NC1CCNCC1)(=O)(=O)C2=CC=C(N(=O)=O)C=C2.Cl

Synonyms:

• Benzenesulfonamide, 4-nitro-N-4-piperidinyl-, hydrochloride (1:1)

4-Nitro-N-(piperidin-4-yl)benzenesulfonamide hydrochloride

CAS: 1233958-29-6

Formula: C₁₁H₁₆ClN₃O₄S

Purity: 95.0%

Molecular weight: 321.78

Ref: 10-F063521