CAS 1233958-30-9

4-Fluoro-N-(3-methoxypropyl)-2-nitrobenzenamine

Description:

4-Fluoro-N-(3-methoxypropyl)-2-nitrobenzenamine is an organic compound characterized by its aromatic structure, which includes a nitro group and a fluorine substituent on the benzene ring. The presence of the amino group (-NH2) indicates that it is an aniline derivative, while the methoxypropyl side chain contributes to its overall hydrophobic character. This compound is likely to exhibit moderate solubility in organic solvents and limited solubility in water due to the presence of both polar (nitro and amino groups) and non-polar (methoxypropyl group) functional groups. The fluorine atom can influence the compound's electronic properties, potentially enhancing its reactivity and stability. Additionally, the nitro group may impart certain electrophilic characteristics, making it a candidate for various chemical reactions, including nucleophilic substitutions. Overall, this compound's unique combination of functional groups suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. However, specific safety and handling guidelines should be followed due to the presence of the nitro group, which can pose health risks.

Formula: C₁₀H₁₃FN₂O₃

InChI: InChI=1S/C10H13FN2O3/c1-16-6-2-5-12-9-4-3-8(11)7-10(9)13(14)15/h3-4,7,12H,2,5-6H2,1H3

InChI key: InChIKey=NURFPKSLGBCWOM-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(NCCCOC)C=CC(F)=C1

Synonyms:

• Benzenamine, 4-fluoro-N-(3-methoxypropyl)-2-nitro-
• 4-Fluoro-N-(3-methoxypropyl)-2-nitrobenzenamine
• 4-Fluoro-N-(3-methoxypropyl)-2-nitroaniline

4-Fluoro-N-(3-methoxypropyl)-2-nitroaniline

CAS: 1233958-30-9

Formula: C₁₀H₁₃FN₂O₃

Purity: 95.0%

Molecular weight: 228.223

Ref: 10-F063345