CAS 1233958-31-0

4-Piperidinamine, N-(1-ethylpropyl)-, hydrochloride (1:2)

Description:

4-Piperidinamine, N-(1-ethylpropyl)-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features an amine functional group, contributing to its basicity and potential reactivity. The presence of the N-(1-ethylpropyl) substituent indicates that it has an ethyl and propyl group attached to the nitrogen atom, which can influence its solubility and interaction with biological systems. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The compound may exhibit biological activity, potentially acting as a ligand or modulator in biochemical pathways. Its specific properties, such as melting point, solubility, and reactivity, would depend on the conditions under which it is studied. Safety data should be consulted for handling and usage, as with all chemical substances.

Formula: C₁₀H₂₂N₂·2ClH

InChI: InChI=1S/C10H22N2.2ClH/c1-3-9(4-2)12-10-5-7-11-8-6-10;;/h9-12H,3-8H2,1-2H3;2*1H

InChI key: InChIKey=MTUKXXVSQHUGRC-UHFFFAOYSA-N

SMILES: N(C(CC)CC)C1CCNCC1.Cl

Synonyms:

• 4-Piperidinamine, N-(1-ethylpropyl)-, hydrochloride (1:2)

N-(Pentan-3-yl)piperidin-4-amine dihydrochloride

CAS: 1233958-31-0

Formula: C₁₀H₂₄Cl₂N₂

Purity: 95.0%

Molecular weight: 243.22

Ref: 10-F063525