
CAS 1233958-34-3
:Benzenesulfonamide, 2-bromo-N-4-piperidinyl-, hydrochloride (1:1)
Description:
Benzenesulfonamide, 2-bromo-N-4-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of a bromine atom at the 2-position of the benzene ring contributes to its reactivity and potential applications in medicinal chemistry. The piperidine moiety enhances its pharmacological profile, often improving solubility and bioavailability. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various formulations. This compound may exhibit biological activity, potentially acting as an inhibitor or modulator in specific biochemical pathways. Its structural features suggest potential uses in drug development, particularly in the fields of antimicrobial or anti-inflammatory therapies. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and environmental impact. Further studies would be necessary to fully elucidate its properties and applications in research and industry.
Formula:C11H15BrN2O2S·ClH
InChI:InChI=1S/C11H15BrN2O2S.ClH/c12-10-3-1-2-4-11(10)17(15,16)14-9-5-7-13-8-6-9;/h1-4,9,13-14H,5-8H2;1H
InChI key:InChIKey=PAVYVMLMJZCVRN-UHFFFAOYSA-N
SMILES:S(NC1CCNCC1)(=O)(=O)C2=C(Br)C=CC=C2.Cl
Synonyms:- Benzenesulfonamide, 2-bromo-N-4-piperidinyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.