CAS 1233958-37-6
:1,1-Dimethylethyl 4-[[[(4-chlorophenyl)amino]carbonyl]amino]-1-piperidinecarboxylate
Description:
1,1-Dimethylethyl 4-[[[(4-chlorophenyl)amino]carbonyl]amino]-1-piperidinecarboxylate, identified by its CAS number 1233958-37-6, is a chemical compound characterized by its complex structure, which includes a piperidine ring and multiple functional groups. This compound features a dimethyl group attached to a tert-butyl moiety, contributing to its steric bulk. The presence of a 4-chlorophenyl group indicates potential interactions with biological targets, particularly in medicinal chemistry. The amino and carbonyl functionalities suggest that it may participate in hydrogen bonding, influencing its solubility and reactivity. Additionally, the carboxylate group can affect the compound's acidity and its ability to form salts. Overall, this compound may exhibit interesting pharmacological properties, making it a candidate for further investigation in drug development or as a biochemical probe. Its specific characteristics, such as melting point, solubility, and biological activity, would require empirical data for a comprehensive understanding.
Formula:C17H24ClN3O3
InChI:InChI=1S/C17H24ClN3O3/c1-17(2,3)24-16(23)21-10-8-14(9-11-21)20-15(22)19-13-6-4-12(18)5-7-13/h4-7,14H,8-11H2,1-3H3,(H2,19,20,22)
InChI key:InChIKey=NGPQJUNSMGTDBX-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CCC(NC(NC2=CC=C(Cl)C=C2)=O)CC1
Synonyms:- 1,1-Dimethylethyl 4-[[[(4-chlorophenyl)amino]carbonyl]amino]-1-piperidinecarboxylate
- 1-Piperidinecarboxylic acid, 4-[[[(4-chlorophenyl)amino]carbonyl]amino]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.