CAS 1233958-38-7

1,1-Dimethylethyl 4-[[(3-methoxyphenyl)methyl]amino]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 4-[[(3-methoxyphenyl)methyl]amino]-1-piperidinecarboxylate, identified by its CAS number 1233958-38-7, is a chemical compound that features a piperidine ring, which is a six-membered nitrogen-containing heterocycle. This compound is characterized by the presence of a dimethyl group attached to a tert-butyl group, contributing to its steric bulk. The methoxyphenyl group indicates the presence of a methoxy substituent on a phenyl ring, which can influence the compound's solubility and reactivity. The amino group linked to the piperidine enhances its potential for forming hydrogen bonds, which can affect its biological activity and interaction with other molecules. The carboxylate functional group suggests that this compound may exhibit acidic properties, potentially influencing its behavior in various chemical environments. Overall, this compound's unique structure may confer specific pharmacological properties, making it of interest in medicinal chemistry and drug development.

Formula: C₁₈H₂₈N₂O₃

InChI: InChI=1S/C18H28N2O3/c1-18(2,3)23-17(21)20-10-8-15(9-11-20)19-13-14-6-5-7-16(12-14)22-4/h5-7,12,15,19H,8-11,13H2,1-4H3

InChI key: InChIKey=BIFDRMKMOMFVCU-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CCC(NCC2=CC(OC)=CC=C2)CC1

Synonyms:

• 1-Piperidinecarboxylic acid, 4-[[(3-methoxyphenyl)methyl]amino]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 4-[[(3-methoxyphenyl)methyl]amino]-1-piperidinecarboxylate
• tert-Butyl 4-(3-methoxybenzylamino)piperidine-1-carboxylate

tert-Butyl 4-(3-methoxybenzylamino)piperidine-1-carboxylate

CAS: 1233958-38-7

Formula: C₁₈H₂₈N₂O₃

Purity: 95.0%

Molecular weight: 320.433

Ref: 10-F063502