CAS 1233958-39-8

1,1-Dimethylethyl 4-[[[(2-bromophenyl)amino]carbonyl]amino]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 4-[[[(2-bromophenyl)amino]carbonyl]amino]-1-piperidinecarboxylate, identified by its CAS number 1233958-39-8, is a chemical compound characterized by its complex structure, which includes a piperidine ring and various functional groups. This compound features a dimethyl group attached to a tert-butyl moiety, contributing to its steric bulk. The presence of a bromophenyl group indicates potential for aromatic interactions, while the amino and carbonyl functionalities suggest it may participate in hydrogen bonding and other polar interactions. The carboxylate group enhances its solubility in polar solvents, making it potentially useful in various chemical applications. Its unique structure may also confer specific biological activities, making it of interest in pharmaceutical research. Overall, the compound's characteristics, including its molecular weight, solubility, and reactivity, would be essential for understanding its behavior in chemical reactions and potential applications in drug development or other fields.

Formula: C₁₇H₂₄BrN₃O₃

InChI: InChI=1S/C17H24BrN3O3/c1-17(2,3)24-16(23)21-10-8-12(9-11-21)19-15(22)20-14-7-5-4-6-13(14)18/h4-7,12H,8-11H2,1-3H3,(H2,19,20,22)

InChI key: InChIKey=LTXFPMMIQZOHOB-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CCC(NC(NC2=C(Br)C=CC=C2)=O)CC1

Synonyms:

• 1,1-Dimethylethyl 4-[[[(2-bromophenyl)amino]carbonyl]amino]-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 4-[[[(2-bromophenyl)amino]carbonyl]amino]-, 1,1-dimethylethyl ester

tert-Butyl 4-[3-(2-bromophenyl)ureido]piperidine-1-carboxylate

CAS: 1233958-39-8

Formula: C₁₇H₂₄BrN₃O₃

Purity: 95.0%

Molecular weight: 398.301

Ref: 10-F063534