CAS 1233958-89-8

1,1-Dimethylethyl 4-[(4-pyridinylcarbonyl)amino]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 4-[(4-pyridinylcarbonyl)amino]-1-piperidinecarboxylate, identified by its CAS number 1233958-89-8, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a pyridine moiety. This compound features a tert-butyl group (1,1-dimethylethyl) that contributes to its steric bulk, potentially influencing its reactivity and solubility. The presence of the carbonyl group linked to the pyridine indicates potential for hydrogen bonding and reactivity in various chemical environments. Additionally, the amino group suggests that the compound may participate in further reactions, such as acylation or amination. Its molecular structure implies that it may exhibit biological activity, making it of interest in medicinal chemistry. The compound's solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, and it may be used in various applications, including pharmaceuticals or agrochemicals. Further studies would be necessary to elucidate its full range of properties and potential uses.

Formula: C₁₆H₂₃N₃O₃

InChI: InChI=1S/C16H23N3O3/c1-16(2,3)22-15(21)19-10-6-13(7-11-19)18-14(20)12-4-8-17-9-5-12/h4-5,8-9,13H,6-7,10-11H2,1-3H3,(H,18,20)

InChI key: InChIKey=AGCGUKHTRDUHFT-UHFFFAOYSA-N

SMILES: N(C(=O)C=1C=CN=CC1)C2CCN(C(OC(C)(C)C)=O)CC2

Synonyms:

• 1,1-Dimethylethyl 4-[(4-pyridinylcarbonyl)amino]-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 4-[(4-pyridinylcarbonyl)amino]-, 1,1-dimethylethyl ester
• tert-Butyl 4-(isonicotinamido)piperidine-1-carboxylate

tert-Butyl 4-(isonicotinamido)piperidine-1-carboxylate

CAS: 1233958-89-8

Formula: C₁₆H₂₃N₃O₃

Purity: 95.0%

Molecular weight: 305.378

Ref: 10-F063388