CAS 1233958-94-5

4-Fluoro-1-(3-methoxypropoxy)-2-nitrobenzene

Description:

4-Fluoro-1-(3-methoxypropoxy)-2-nitrobenzene is an organic compound characterized by its aromatic structure, which includes a nitro group and a fluorine atom attached to a benzene ring. The presence of the methoxypropoxy group introduces a degree of polarity and enhances solubility in organic solvents. This compound is likely to exhibit moderate to high stability under standard conditions, although it may be sensitive to strong acids or bases due to the presence of the nitro group. The fluorine atom can influence the compound's reactivity and electronic properties, potentially making it a candidate for various chemical reactions, including nucleophilic substitutions. Its applications may extend to fields such as pharmaceuticals, agrochemicals, or materials science, where such functionalized aromatic compounds are often utilized. Safety data and handling precautions should be observed, as nitro compounds can be hazardous. Overall, 4-Fluoro-1-(3-methoxypropoxy)-2-nitrobenzene represents a versatile structure with potential utility in synthetic chemistry.

Formula: C₁₀H₁₂FNO₄

InChI: InChI=1S/C10H12FNO4/c1-15-5-2-6-16-10-4-3-8(11)7-9(10)12(13)14/h3-4,7H,2,5-6H2,1H3

InChI key: InChIKey=IXSGKDOHZWMOTF-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(OCCCOC)C=CC(F)=C1

4-Fluoro-1-(3-methoxypropoxy)-2-nitrobenzene

CAS: 1233958-94-5

Formula: C₁₀H₁₂FNO₄

Purity: 95.0%

Molecular weight: 229.207

Ref: 10-F063432