CymitQuimica logo

CAS 1233967-22-0

:

1-(2-Amino-5-bromophenyl)-2,2,2-trifluoroethanone

Description:
1-(2-Amino-5-bromophenyl)-2,2,2-trifluoroethanone is a chemical compound characterized by its unique structure, which includes a trifluoroethanone moiety and an amino-substituted bromophenyl group. This compound typically exhibits properties associated with both aromatic and halogenated compounds, such as increased reactivity due to the presence of the amino group and the electron-withdrawing trifluoromethyl group. The bromine atom contributes to its potential for electrophilic substitution reactions, while the trifluoromethyl group enhances lipophilicity and may influence biological activity. The presence of the amino group suggests potential for hydrogen bonding, which can affect solubility and interaction with biological targets. This compound may be of interest in medicinal chemistry and materials science due to its potential applications in drug development and as a building block for more complex molecules. Its specific reactivity and stability would depend on the surrounding conditions, including pH and solvent environment. Overall, 1-(2-Amino-5-bromophenyl)-2,2,2-trifluoroethanone represents a versatile structure with significant implications in various chemical fields.
Formula:C8H5BrF3NO
InChI:InChI=1S/C8H5BrF3NO/c9-4-1-2-6(13)5(3-4)7(14)8(10,11)12/h1-3H,13H2
InChI key:InChIKey=CWTOSTWUQONVEW-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(=O)C1=C(N)C=CC(Br)=C1
Synonyms:
  • 1-(2-Amino-5-bromophenyl)-2,2,2-trifluoroethan-1-one
  • Ethanone, 1-(2-amino-5-bromophenyl)-2,2,2-trifluoro-
  • 1-(2-Amino-5-bromophenyl)-2,2,2-trifluoroethanone
Found 4 products.